C20H18N2O4S — CID 3158543
naphthalen-1-ylmethyl 2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetate (PubChem CID 3158543) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetate.
| Compound Name | naphthalen-1-ylmethyl 2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 3158543 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | naphthalen-1-ylmethyl 2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetate |
| SMILES | O=C(CNC(=O)c1cccs1)NCC(=O)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H18N2O4S/c23-18(11-22-20(25)17-9-4-10-27-17)21-12-19(24)26-13-15-7-3-6-14-5-1-2-8-16(14)15/h1-10H,11-13H2,(H,21,23)(H,22,25) |
| InChIKey | YHNMXBKVAMBFKW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |