C16H15NO5S — CID 957235
methyl 3-[[2-(thiophene-2-carbonylamino)acetyl]oxymethyl]benzoate (PubChem CID 957235) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is methyl 3-[[2-(thiophene-2-carbonylamino)acetyl]oxymethyl]benzoate.
| Compound Name | methyl 3-[[2-(thiophene-2-carbonylamino)acetyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 957235 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | methyl 3-[[2-(thiophene-2-carbonylamino)acetyl]oxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COC(=O)CNC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C16H15NO5S/c1-21-16(20)12-5-2-4-11(8-12)10-22-14(18)9-17-15(19)13-6-3-7-23-13/h2-8H,9-10H2,1H3,(H,17,19) |
| InChIKey | UTFVIRUFICVBSF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |