C16H16FNO3S — CID 86977749
(3-fluorophenyl)methyl 4-(thiophene-2-carbonylamino)butanoate (PubChem CID 86977749) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 4-(thiophene-2-carbonylamino)butanoate.
| Compound Name | (3-fluorophenyl)methyl 4-(thiophene-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 86977749 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (3-fluorophenyl)methyl 4-(thiophene-2-carbonylamino)butanoate |
| SMILES | O=C(CCCNC(=O)c1cccs1)OCc1cccc(F)c1 |
| InChI | InChI=1S/C16H16FNO3S/c17-13-5-1-4-12(10-13)11-21-15(19)7-2-8-18-16(20)14-6-3-9-22-14/h1,3-6,9-10H,2,7-8,11H2,(H,18,20) |
| InChIKey | KTHAVICMLKNRHF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|