C13H11F2NOS — CID 62295549
N-[2-(3,5-difluorophenyl)ethyl]thiophene-2-carboxamide (PubChem CID 62295549) has the molecular formula C13H11F2NOS and a molecular weight of 267.30 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 62295549 |
| Molecular Formula | C13H11F2NOS |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCc1cc(F)cc(F)c1)c1cccs1 |
| InChI | InChI=1S/C13H11F2NOS/c14-10-6-9(7-11(15)8-10)3-4-16-13(17)12-2-1-5-18-12/h1-2,5-8H,3-4H2,(H,16,17) |
| InChIKey | FPKBIKHVNKIRQK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |