C11H7F2NOS — CID 2986846
N-(3,5-difluorophenyl)thiophene-2-carboxamide (PubChem CID 2986846) has the molecular formula C11H7F2NOS and a molecular weight of 239.25 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)thiophene-2-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2986846 |
| Molecular Formula | C11H7F2NOS |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | N-(3,5-difluorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)c1cccs1 |
| InChI | InChI=1S/C11H7F2NOS/c12-7-4-8(13)6-9(5-7)14-11(15)10-2-1-3-16-10/h1-6H,(H,14,15) |
| InChIKey | VNKCICWRZGSRDI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |