C11H6F3NOS — CID 63372873
N-(2,4,5-trifluorophenyl)thiophene-2-carboxamide (PubChem CID 63372873) has the molecular formula C11H6F3NOS and a molecular weight of 257.24 g/mol. Its IUPAC name is N-(2,4,5-trifluorophenyl)thiophene-2-carboxamide.
| Compound Name | N-(2,4,5-trifluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63372873 |
| Molecular Formula | C11H6F3NOS |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | N-(2,4,5-trifluorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)cc1F)c1cccs1 |
| InChI | InChI=1S/C11H6F3NOS/c12-6-4-8(14)9(5-7(6)13)15-11(16)10-2-1-3-17-10/h1-5H,(H,15,16) |
| InChIKey | JGOYELZLDABVFM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|