C11H9FN2O3S2 — CID 61129962
N-(2-fluoro-4-sulfamoylphenyl)thiophene-2-carboxamide (PubChem CID 61129962) has the molecular formula C11H9FN2O3S2 and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(2-fluoro-4-sulfamoylphenyl)thiophene-2-carboxamide.
| Compound Name | N-(2-fluoro-4-sulfamoylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61129962 |
| Molecular Formula | C11H9FN2O3S2 |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | N-(2-fluoro-4-sulfamoylphenyl)thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cccs2)c(F)c1 |
| InChI | InChI=1S/C11H9FN2O3S2/c12-8-6-7(19(13,16)17)3-4-9(8)14-11(15)10-2-1-5-18-10/h1-6H,(H,14,15)(H2,13,16,17) |
| InChIKey | GQOBWHGVGPGUJD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |