C11H16FN3O3S — CID 79162190
1,1-diethyl-3-(2-fluoro-4-sulfamoylphenyl)urea (PubChem CID 79162190) has the molecular formula C11H16FN3O3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-fluoro-4-sulfamoylphenyl)urea.
| Compound Name | 1,1-diethyl-3-(2-fluoro-4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 79162190 |
| Molecular Formula | C11H16FN3O3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1,1-diethyl-3-(2-fluoro-4-sulfamoylphenyl)urea |
| SMILES | CCN(CC)C(=O)Nc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C11H16FN3O3S/c1-3-15(4-2)11(16)14-10-6-5-8(7-9(10)12)19(13,17)18/h5-7H,3-4H2,1-2H3,(H,14,16)(H2,13,17,18) |
| InChIKey | RCGKHQZNOCFBPV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |