C11H15FN2O3S2 — CID 114217249
N-(2-fluoro-4-sulfamoylphenyl)-2-methyl-3-methylsulfanylpropanamide (PubChem CID 114217249) has the molecular formula C11H15FN2O3S2 and a molecular weight of 306.38 g/mol. Its IUPAC name is N-(2-fluoro-4-sulfamoylphenyl)-2-methyl-3-methylsulfanylpropanamide.
| Compound Name | N-(2-fluoro-4-sulfamoylphenyl)-2-methyl-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 114217249 |
| Molecular Formula | C11H15FN2O3S2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N-(2-fluoro-4-sulfamoylphenyl)-2-methyl-3-methylsulfanylpropanamide |
| SMILES | CSCC(C)C(=O)Nc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C11H15FN2O3S2/c1-7(6-18-2)11(15)14-10-4-3-8(5-9(10)12)19(13,16)17/h3-5,7H,6H2,1-2H3,(H,14,15)(H2,13,16,17) |
| InChIKey | ARIBWSRZOIGYGP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |