C12H19FN2O2S — CID 64599794
4-(2,3-dimethylbutylamino)-3-fluorobenzenesulfonamide (PubChem CID 64599794) has the molecular formula C12H19FN2O2S and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-(2,3-dimethylbutylamino)-3-fluorobenzenesulfonamide.
| Compound Name | 4-(2,3-dimethylbutylamino)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 64599794 |
| Molecular Formula | C12H19FN2O2S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-(2,3-dimethylbutylamino)-3-fluorobenzenesulfonamide |
| SMILES | CC(C)C(C)CNc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C12H19FN2O2S/c1-8(2)9(3)7-15-12-5-4-10(6-11(12)13)18(14,16)17/h4-6,8-9,15H,7H2,1-3H3,(H2,14,16,17) |
| InChIKey | DCFDZMZUIMKOKK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |