C14H21FN2O3S — CID 63821086
N-(2-fluoro-4-sulfamoylphenyl)-3,4,4-trimethylpentanamide (PubChem CID 63821086) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(2-fluoro-4-sulfamoylphenyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(2-fluoro-4-sulfamoylphenyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 63821086 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(2-fluoro-4-sulfamoylphenyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)Nc1ccc(S(N)(=O)=O)cc1F)C(C)(C)C |
| InChI | InChI=1S/C14H21FN2O3S/c1-9(14(2,3)4)7-13(18)17-12-6-5-10(8-11(12)15)21(16,19)20/h5-6,8-9H,7H2,1-4H3,(H,17,18)(H2,16,19,20) |
| InChIKey | PABGKIZXSASCBP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |