C10H13FN2O5S2 — CID 104520209
N-(2-fluoro-4-sulfamoylphenyl)-2-methylsulfonylpropanamide (PubChem CID 104520209) has the molecular formula C10H13FN2O5S2 and a molecular weight of 324.36 g/mol. Its IUPAC name is N-(2-fluoro-4-sulfamoylphenyl)-2-methylsulfonylpropanamide.
| Compound Name | N-(2-fluoro-4-sulfamoylphenyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104520209 |
| Molecular Formula | C10H13FN2O5S2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-(2-fluoro-4-sulfamoylphenyl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)Nc1ccc(S(N)(=O)=O)cc1F)S(C)(=O)=O |
| InChI | InChI=1S/C10H13FN2O5S2/c1-6(19(2,15)16)10(14)13-9-4-3-7(5-8(9)11)20(12,17)18/h3-6H,1-2H3,(H,13,14)(H2,12,17,18) |
| InChIKey | MDBOVHQZJIDESE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |