C11H11FN4O3S — CID 61129598
N-(2-fluoro-4-sulfamoylphenyl)-2-methylpyrazole-3-carboxamide (PubChem CID 61129598) has the molecular formula C11H11FN4O3S and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(2-fluoro-4-sulfamoylphenyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(2-fluoro-4-sulfamoylphenyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 61129598 |
| Molecular Formula | C11H11FN4O3S |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(2-fluoro-4-sulfamoylphenyl)-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C11H11FN4O3S/c1-16-10(4-5-14-16)11(17)15-9-3-2-7(6-8(9)12)20(13,18)19/h2-6H,1H3,(H,15,17)(H2,13,18,19) |
| InChIKey | DMVPJVOENWVJHP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |