C11H11ClN4O3S — CID 61131082
N-(2-chloro-5-sulfamoylphenyl)-2-methylpyrazole-3-carboxamide (PubChem CID 61131082) has the molecular formula C11H11ClN4O3S and a molecular weight of 314.75 g/mol. Its IUPAC name is N-(2-chloro-5-sulfamoylphenyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(2-chloro-5-sulfamoylphenyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 61131082 |
| Molecular Formula | C11H11ClN4O3S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-(2-chloro-5-sulfamoylphenyl)-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1cc(S(N)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C11H11ClN4O3S/c1-16-10(4-5-14-16)11(17)15-9-6-7(20(13,18)19)2-3-8(9)12/h2-6H,1H3,(H,15,17)(H2,13,18,19) |
| InChIKey | HKTJQGIQVAFOMB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |