C11H10ClN3O4S — CID 61128987
N-(2-chloro-5-sulfamoylphenyl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 61128987) has the molecular formula C11H10ClN3O4S and a molecular weight of 315.74 g/mol. Its IUPAC name is N-(2-chloro-5-sulfamoylphenyl)-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-chloro-5-sulfamoylphenyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 61128987 |
| Molecular Formula | C11H10ClN3O4S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-(2-chloro-5-sulfamoylphenyl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(S(N)(=O)=O)ccc2Cl)no1 |
| InChI | InChI=1S/C11H10ClN3O4S/c1-6-4-10(15-19-6)11(16)14-9-5-7(20(13,17)18)2-3-8(9)12/h2-5H,1H3,(H,14,16)(H2,13,17,18) |
| InChIKey | FLIXMCXPTQXVGX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |