C12H11ClN4O3S — CID 61052794
6-chloro-N-(2-methyl-5-sulfamoylphenyl)pyridazine-3-carboxamide (PubChem CID 61052794) has the molecular formula C12H11ClN4O3S and a molecular weight of 326.77 g/mol. Its IUPAC name is 6-chloro-N-(2-methyl-5-sulfamoylphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-chloro-N-(2-methyl-5-sulfamoylphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 61052794 |
| Molecular Formula | C12H11ClN4O3S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 6-chloro-N-(2-methyl-5-sulfamoylphenyl)pyridazine-3-carboxamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NC(=O)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C12H11ClN4O3S/c1-7-2-3-8(21(14,19)20)6-10(7)15-12(18)9-4-5-11(13)17-16-9/h2-6H,1H3,(H,15,18)(H2,14,19,20) |
| InChIKey | VCPNRGRAMLBNEJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |