C13H13ClN2O3S2 — CID 103405078
3-chloro-4-methyl-N-(2-methyl-5-sulfamoylphenyl)thiophene-2-carboxamide (PubChem CID 103405078) has the molecular formula C13H13ClN2O3S2 and a molecular weight of 344.85 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-(2-methyl-5-sulfamoylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-chloro-4-methyl-N-(2-methyl-5-sulfamoylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103405078 |
| Molecular Formula | C13H13ClN2O3S2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 3-chloro-4-methyl-N-(2-methyl-5-sulfamoylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NC(=O)c1scc(C)c1Cl |
| InChI | InChI=1S/C13H13ClN2O3S2/c1-7-3-4-9(21(15,18)19)5-10(7)16-13(17)12-11(14)8(2)6-20-12/h3-6H,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | SEQNJABQHPCHIJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |