C14H15ClN2O3S2 — CID 2812461
3-chloro-N-[5-(dimethylsulfamoyl)-2-methylphenyl]thiophene-2-carboxamide (PubChem CID 2812461) has the molecular formula C14H15ClN2O3S2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 3-chloro-N-[5-(dimethylsulfamoyl)-2-methylphenyl]thiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[5-(dimethylsulfamoyl)-2-methylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2812461 |
| Molecular Formula | C14H15ClN2O3S2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 3-chloro-N-[5-(dimethylsulfamoyl)-2-methylphenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)c1sccc1Cl |
| InChI | InChI=1S/C14H15ClN2O3S2/c1-9-4-5-10(22(19,20)17(2)3)8-12(9)16-14(18)13-11(15)6-7-21-13/h4-8H,1-3H3,(H,16,18) |
| InChIKey | AAWGRJIDWAFSJN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |