C18H19ClN2O4S — CID 110618400
N-(5-acetyl-2-methylphenyl)-2-chloro-5-(dimethylsulfamoyl)benzamide (PubChem CID 110618400) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is N-(5-acetyl-2-methylphenyl)-2-chloro-5-(dimethylsulfamoyl)benzamide.
| Compound Name | N-(5-acetyl-2-methylphenyl)-2-chloro-5-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 110618400 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-(5-acetyl-2-methylphenyl)-2-chloro-5-(dimethylsulfamoyl)benzamide |
| SMILES | CC(=O)c1ccc(C)c(NC(=O)c2cc(S(=O)(=O)N(C)C)ccc2Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-11-5-6-13(12(2)22)9-17(11)20-18(23)15-10-14(7-8-16(15)19)26(24,25)21(3)4/h5-10H,1-4H3,(H,20,23) |
| InChIKey | CQWZGSMUVAOCMV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |