C22H24ClN3O3S — CID 24580810
2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[5-(dimethylsulfamoyl)-2-methylphenyl]benzamide (PubChem CID 24580810) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[5-(dimethylsulfamoyl)-2-methylphenyl]benzamide.
| Compound Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[5-(dimethylsulfamoyl)-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 24580810 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[5-(dimethylsulfamoyl)-2-methylphenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)c1cc(-n2c(C)ccc2C)ccc1Cl |
| InChI | InChI=1S/C22H24ClN3O3S/c1-14-6-10-18(30(28,29)25(4)5)13-21(14)24-22(27)19-12-17(9-11-20(19)23)26-15(2)7-8-16(26)3/h6-13H,1-5H3,(H,24,27) |
| InChIKey | DTAQRCCBOWOOTA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|