C17H19ClN2O6S2 — CID 55362920
2-chloro-5-(dimethylsulfamoyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)benzamide (PubChem CID 55362920) has the molecular formula C17H19ClN2O6S2 and a molecular weight of 446.93 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)benzamide.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 55362920 |
| Molecular Formula | C17H19ClN2O6S2 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)benzamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2cc(S(=O)(=O)N(C)C)ccc2Cl)c1 |
| InChI | InChI=1S/C17H19ClN2O6S2/c1-4-27(23,24)11-6-8-16(21)15(10-11)19-17(22)13-9-12(5-7-14(13)18)28(25,26)20(2)3/h5-10,21H,4H2,1-3H3,(H,19,22) |
| InChIKey | OGUOAUMBZQZBJL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|