C15H14INO4S — CID 78794976
N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-iodobenzamide (PubChem CID 78794976) has the molecular formula C15H14INO4S and a molecular weight of 431.25 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-iodobenzamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 78794976 |
| Molecular Formula | C15H14INO4S |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-iodobenzamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C15H14INO4S/c1-2-22(20,21)10-7-8-14(18)13(9-10)17-15(19)11-5-3-4-6-12(11)16/h3-9,18H,2H2,1H3,(H,17,19) |
| InChIKey | ULRPXTXTLIUPOJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|