C17H19NO5S — CID 31618597
N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(methoxymethyl)benzamide (PubChem CID 31618597) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(methoxymethyl)benzamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 31618597 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-(methoxymethyl)benzamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2cccc(COC)c2)c1 |
| InChI | InChI=1S/C17H19NO5S/c1-3-24(21,22)14-7-8-16(19)15(10-14)18-17(20)13-6-4-5-12(9-13)11-23-2/h4-10,19H,3,11H2,1-2H3,(H,18,20) |
| InChIKey | IDOUKJQODXNLNF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|