C15H12Cl2FNO4S — CID 51206951
2,4-dichloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-fluorobenzamide (PubChem CID 51206951) has the molecular formula C15H12Cl2FNO4S and a molecular weight of 392.24 g/mol. Its IUPAC name is 2,4-dichloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 51206951 |
| Molecular Formula | C15H12Cl2FNO4S |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 2,4-dichloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-fluorobenzamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2cc(F)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H12Cl2FNO4S/c1-2-24(22,23)8-3-4-14(20)13(5-8)19-15(21)9-6-12(18)11(17)7-10(9)16/h3-7,20H,2H2,1H3,(H,19,21) |
| InChIKey | LMDPOOSGEUFWIC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|