C13H13N3O5S — CID 46523475
N-(5-ethylsulfonyl-2-hydroxyphenyl)-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 46523475) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 46523475 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C13H13N3O5S/c1-2-22(20,21)8-3-5-11(17)10(7-8)14-13(19)9-4-6-12(18)16-15-9/h3-7,17H,2H2,1H3,(H,14,19)(H,16,18) |
| InChIKey | QUWMJXYJXZGCOE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|