C12H12N4O6S — CID 135803302
N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135803302) has the molecular formula C12H12N4O6S and a molecular weight of 340.32 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803302 |
| Molecular Formula | C12H12N4O6S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2cc([N+](=O)[O-])[nH]n2)c1 |
| InChI | InChI=1S/C12H12N4O6S/c1-2-23(21,22)7-3-4-10(17)8(5-7)13-12(18)9-6-11(15-14-9)16(19)20/h3-6,17H,2H2,1H3,(H,13,18)(H,14,15) |
| InChIKey | TYVXIPCRBJBKIJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 155.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|