C13H14N4O6S — CID 19478569
N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-methyl-4-nitropyrazole-5-carboxamide (PubChem CID 19478569) has the molecular formula C13H14N4O6S and a molecular weight of 354.34 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-methyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-methyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19478569 |
| Molecular Formula | C13H14N4O6S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-methyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2c([N+](=O)[O-])cnn2C)c1 |
| InChI | InChI=1S/C13H14N4O6S/c1-3-24(22,23)8-4-5-11(18)9(6-8)15-13(19)12-10(17(20)21)7-14-16(12)2/h4-7,18H,3H2,1-2H3,(H,15,19) |
| InChIKey | SVLZDPZEUWVJRH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|