C15H18N4O6S — CID 19551831
N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-(4-nitropyrazol-1-yl)butanamide (PubChem CID 19551831) has the molecular formula C15H18N4O6S and a molecular weight of 382.40 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-(4-nitropyrazol-1-yl)butanamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-(4-nitropyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 19551831 |
| Molecular Formula | C15H18N4O6S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-2-(4-nitropyrazol-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1cc(S(=O)(=O)CC)ccc1O)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C15H18N4O6S/c1-3-13(18-9-10(8-16-18)19(22)23)15(21)17-12-7-11(5-6-14(12)20)26(24,25)4-2/h5-9,13,20H,3-4H2,1-2H3,(H,17,21) |
| InChIKey | XBMOBOOSCXVXEE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|