C7H9N3O4 — CID 7017284
(2R)-2-(4-nitropyrazol-1-yl)butanoic acid (PubChem CID 7017284) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is (2R)-2-(4-nitropyrazol-1-yl)butanoic acid.
| Compound Name | (2R)-2-(4-nitropyrazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 7017284 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (2R)-2-(4-nitropyrazol-1-yl)butanoic acid |
| SMILES | CC[C@H](C(=O)O)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C7H9N3O4/c1-2-6(7(11)12)9-4-5(3-8-9)10(13)14/h3-4,6H,2H2,1H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | WCWIOBFYLVTFFO-ZCFIWIBFSA-N |
| XLogP | 0.83 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|