C7H9ClN2O2 — CID 7017286
(2R)-2-(4-chloropyrazol-1-yl)butanoic acid (PubChem CID 7017286) has the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. Its IUPAC name is (2R)-2-(4-chloropyrazol-1-yl)butanoic acid.
| Compound Name | (2R)-2-(4-chloropyrazol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 7017286 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (2R)-2-(4-chloropyrazol-1-yl)butanoic acid |
| SMILES | CC[C@H](C(=O)O)n1cc(Cl)cn1 |
| InChI | InChI=1S/C7H9ClN2O2/c1-2-6(7(11)12)10-4-5(8)3-9-10/h3-4,6H,2H2,1H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | NQGXFNDVJVYKNU-ZCFIWIBFSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |