C15H16F2N4O4 — CID 19551707
N-[4-(difluoromethoxy)-2-methylphenyl]-2-(4-nitropyrazol-1-yl)butanamide (PubChem CID 19551707) has the molecular formula C15H16F2N4O4 and a molecular weight of 354.31 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-2-methylphenyl]-2-(4-nitropyrazol-1-yl)butanamide.
| Compound Name | N-[4-(difluoromethoxy)-2-methylphenyl]-2-(4-nitropyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 19551707 |
| Molecular Formula | C15H16F2N4O4 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[4-(difluoromethoxy)-2-methylphenyl]-2-(4-nitropyrazol-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(OC(F)F)cc1C)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C15H16F2N4O4/c1-3-13(20-8-10(7-18-20)21(23)24)14(22)19-12-5-4-11(6-9(12)2)25-15(16)17/h4-8,13,15H,3H2,1-2H3,(H,19,22) |
| InChIKey | BGNAFKOOFSQEDR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|