C18H16N6O6 — CID 19551796
2-(4-nitropyrazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)butanamide (PubChem CID 19551796) has the molecular formula C18H16N6O6 and a molecular weight of 412.36 g/mol. Its IUPAC name is 2-(4-nitropyrazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)butanamide.
| Compound Name | 2-(4-nitropyrazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)butanamide |
|---|---|
| PubChem CID | 19551796 |
| Molecular Formula | C18H16N6O6 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-(4-nitropyrazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)butanamide |
| SMILES | CCC(C(=O)Nc1cc(Oc2cccnc2)cc([N+](=O)[O-])c1)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C18H16N6O6/c1-2-17(22-11-14(9-20-22)24(28)29)18(25)21-12-6-13(23(26)27)8-16(7-12)30-15-4-3-5-19-10-15/h3-11,17H,2H2,1H3,(H,21,25) |
| InChIKey | QWBMGYIRSNHVPH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|