C20H16BrF3N4O4 — CID 19551489
2-(4-bromopyrazol-1-yl)-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]butanamide (PubChem CID 19551489) has the molecular formula C20H16BrF3N4O4 and a molecular weight of 513.27 g/mol. Its IUPAC name is 2-(4-bromopyrazol-1-yl)-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]butanamide.
| Compound Name | 2-(4-bromopyrazol-1-yl)-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 19551489 |
| Molecular Formula | C20H16BrF3N4O4 |
| Molecular Weight | 513.27 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | 2-(4-bromopyrazol-1-yl)-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]butanamide |
| SMILES | CCC(C(=O)Nc1cc(Oc2cccc(C(F)(F)F)c2)cc([N+](=O)[O-])c1)n1cc(Br)cn1 |
| InChI | InChI=1S/C20H16BrF3N4O4/c1-2-18(27-11-13(21)10-25-27)19(29)26-14-7-15(28(30)31)9-17(8-14)32-16-5-3-4-12(6-16)20(22,23)24/h3-11,18H,2H2,1H3,(H,26,29) |
| InChIKey | NMQPUJCOSGSLSL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.27 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|