C22H14F3N5O7 — CID 19460940
5-[(4-nitropyrazol-1-yl)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide (PubChem CID 19460940) has the molecular formula C22H14F3N5O7 and a molecular weight of 517.38 g/mol. Its IUPAC name is 5-[(4-nitropyrazol-1-yl)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-nitropyrazol-1-yl)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19460940 |
| Molecular Formula | C22H14F3N5O7 |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 5-[(4-nitropyrazol-1-yl)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Oc2cccc(C(F)(F)F)c2)cc([N+](=O)[O-])c1)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C22H14F3N5O7/c23-22(24,25)13-2-1-3-17(6-13)36-19-8-14(7-15(9-19)29(32)33)27-21(31)20-5-4-18(37-20)12-28-11-16(10-26-28)30(34)35/h1-11H,12H2,(H,27,31) |
| InChIKey | REOMQNBOOZLCPY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|