C25H16ClF3N2O6 — CID 19458779
5-[(2-chlorophenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide (PubChem CID 19458779) has the molecular formula C25H16ClF3N2O6 and a molecular weight of 532.86 g/mol. Its IUPAC name is 5-[(2-chlorophenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-chlorophenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19458779 |
| Molecular Formula | C25H16ClF3N2O6 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | 5-[(2-chlorophenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Oc2cccc(C(F)(F)F)c2)cc([N+](=O)[O-])c1)c1ccc(COc2ccccc2Cl)o1 |
| InChI | InChI=1S/C25H16ClF3N2O6/c26-21-6-1-2-7-22(21)35-14-19-8-9-23(37-19)24(32)30-16-11-17(31(33)34)13-20(12-16)36-18-5-3-4-15(10-18)25(27,28)29/h1-13H,14H2,(H,30,32) |
| InChIKey | WSSTZIPRUQUQDA-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|