C25H16F3N3O8 — CID 19465527
5-[(4-nitrophenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide (PubChem CID 19465527) has the molecular formula C25H16F3N3O8 and a molecular weight of 543.41 g/mol. Its IUPAC name is 5-[(4-nitrophenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-nitrophenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465527 |
| Molecular Formula | C25H16F3N3O8 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | 5-[(4-nitrophenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Oc2cccc(C(F)(F)F)c2)cc([N+](=O)[O-])c1)c1ccc(COc2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C25H16F3N3O8/c26-25(27,28)15-2-1-3-20(10-15)38-22-12-16(11-18(13-22)31(35)36)29-24(32)23-9-8-21(39-23)14-37-19-6-4-17(5-7-19)30(33)34/h1-13H,14H2,(H,29,32) |
| InChIKey | WWJWSSIFUKHQMZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|