C27H24N2O6 — CID 19446659
5-[(4-ethylphenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19446659) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is 5-[(4-ethylphenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-ethylphenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446659 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 5-[(4-ethylphenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | CCc1ccc(OCc2ccc(C(=O)Nc3cc(Oc4cccc(C)c4)cc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C27H24N2O6/c1-3-19-7-9-22(10-8-19)33-17-24-11-12-26(35-24)27(30)28-20-14-21(29(31)32)16-25(15-20)34-23-6-4-5-18(2)13-23/h4-16H,3,17H2,1-2H3,(H,28,30) |
| InChIKey | MDDQEHWRYUFGPY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|