C25H18ClN3O8 — CID 19461888
5-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19461888) has the molecular formula C25H18ClN3O8 and a molecular weight of 523.89 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461888 |
| Molecular Formula | C25H18ClN3O8 |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenoxy)methyl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1cccc(Oc2cc(NC(=O)c3ccc(COc4ccc([N+](=O)[O-])cc4Cl)o3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C25H18ClN3O8/c1-15-3-2-4-19(9-15)36-21-11-16(10-18(12-21)29(33)34)27-25(30)24-8-6-20(37-24)14-35-23-7-5-17(28(31)32)13-22(23)26/h2-13H,14H2,1H3,(H,27,30) |
| InChIKey | POEORBSJXPAWLI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|