C27H21F3N2O6 — CID 19452802
5-[(2,5-dimethylphenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide (PubChem CID 19452802) has the molecular formula C27H21F3N2O6 and a molecular weight of 526.47 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide.
| Compound Name | 5-[(2,5-dimethylphenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19452802 |
| Molecular Formula | C27H21F3N2O6 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 5-[(2,5-dimethylphenoxy)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)c(OCc2ccc(C(=O)Nc3cc(Oc4cccc(C(F)(F)F)c4)cc([N+](=O)[O-])c3)o2)c1 |
| InChI | InChI=1S/C27H21F3N2O6/c1-16-6-7-17(2)25(10-16)36-15-22-8-9-24(38-22)26(33)31-19-12-20(32(34)35)14-23(13-19)37-21-5-3-4-18(11-21)27(28,29)30/h3-14H,15H2,1-2H3,(H,31,33) |
| InChIKey | WEJNEIKVRHMUQY-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|