C26H19Cl3N2O6 — CID 19415571
N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19415571) has the molecular formula C26H19Cl3N2O6 and a molecular weight of 561.81 g/mol. Its IUPAC name is N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19415571 |
| Molecular Formula | C26H19Cl3N2O6 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-5-[(2,4,6-trichlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)c(Oc2cc(NC(=O)c3ccc(COc4c(Cl)cc(Cl)cc4Cl)o3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H19Cl3N2O6/c1-14-3-4-15(2)24(7-14)37-20-11-17(10-18(12-20)31(33)34)30-26(32)23-6-5-19(36-23)13-35-25-21(28)8-16(27)9-22(25)29/h3-12H,13H2,1-2H3,(H,30,32) |
| InChIKey | SPSGPUNZPUSYNJ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|