C25H19BrN2O6 — CID 19450327
5-[(2-bromophenoxy)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19450327) has the molecular formula C25H19BrN2O6 and a molecular weight of 523.34 g/mol. Its IUPAC name is 5-[(2-bromophenoxy)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-bromophenoxy)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19450327 |
| Molecular Formula | C25H19BrN2O6 |
| Molecular Weight | 523.34 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | 5-[(2-bromophenoxy)methyl]-N-[3-(2-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1Oc1cc(NC(=O)c2ccc(COc3ccccc3Br)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H19BrN2O6/c1-16-6-2-4-8-22(16)34-20-13-17(12-18(14-20)28(30)31)27-25(29)24-11-10-19(33-24)15-32-23-9-5-3-7-21(23)26/h2-14H,15H2,1H3,(H,27,29) |
| InChIKey | ROSPYABHJBVANU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.34 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|