C26H21N3O9 — CID 19461714
N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461714) has the molecular formula C26H21N3O9 and a molecular weight of 519.47 g/mol. Its IUPAC name is N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461714 |
| Molecular Formula | C26H21N3O9 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | COc1ccccc1Oc1cc(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])c(C)c3)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H21N3O9/c1-16-11-19(7-9-22(16)29(33)34)36-15-20-8-10-25(37-20)26(30)27-17-12-18(28(31)32)14-21(13-17)38-24-6-4-3-5-23(24)35-2/h3-14H,15H2,1-2H3,(H,27,30) |
| InChIKey | WCGMFBAAIWEBNJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 156.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|