C26H20N2O9 — CID 19465711
5-(1,3-benzodioxol-5-yloxymethyl)-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19465711) has the molecular formula C26H20N2O9 and a molecular weight of 504.45 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yloxymethyl)-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465711 |
| Molecular Formula | C26H20N2O9 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | COc1ccccc1Oc1cc(NC(=O)c2ccc(COc3ccc4c(c3)OCO4)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H20N2O9/c1-32-21-4-2-3-5-23(21)37-20-11-16(10-17(12-20)28(30)31)27-26(29)24-9-7-19(36-24)14-33-18-6-8-22-25(13-18)35-15-34-22/h2-13H,14-15H2,1H3,(H,27,29) |
| InChIKey | PUMMYSNWCAPTJM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|