C22H17N5O8 — CID 19460915
N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 19460915) has the molecular formula C22H17N5O8 and a molecular weight of 479.41 g/mol. Its IUPAC name is N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19460915 |
| Molecular Formula | C22H17N5O8 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | COc1ccccc1Oc1cc(NC(=O)c2ccc(Cn3cc([N+](=O)[O-])cn3)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17N5O8/c1-33-19-4-2-3-5-20(19)35-18-9-14(8-15(10-18)26(29)30)24-22(28)21-7-6-17(34-21)13-25-12-16(11-23-25)27(31)32/h2-12H,13H2,1H3,(H,24,28) |
| InChIKey | RTZQIXSYSHHKQE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 164.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|