C27H24N2O7 — CID 19446937
5-[(2,6-dimethylphenoxy)methyl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19446937) has the molecular formula C27H24N2O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenoxy)methyl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(2,6-dimethylphenoxy)methyl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446937 |
| Molecular Formula | C27H24N2O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 5-[(2,6-dimethylphenoxy)methyl]-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | COc1ccccc1Oc1cc(NC(=O)c2ccc(COc3c(C)cccc3C)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H24N2O7/c1-17-7-6-8-18(2)26(17)34-16-21-11-12-25(35-21)27(30)28-19-13-20(29(31)32)15-22(14-19)36-24-10-5-4-9-23(24)33-3/h4-15H,16H2,1-3H3,(H,28,30) |
| InChIKey | SOFXMSNLXDIOKN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|