C23H18N2O6 — CID 19412890
N-(3-methoxy-5-nitrophenyl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide (PubChem CID 19412890) has the molecular formula C23H18N2O6 and a molecular weight of 418.41 g/mol. Its IUPAC name is N-(3-methoxy-5-nitrophenyl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-(3-methoxy-5-nitrophenyl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19412890 |
| Molecular Formula | C23H18N2O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(3-methoxy-5-nitrophenyl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(COc3cccc4ccccc34)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18N2O6/c1-29-19-12-16(11-17(13-19)25(27)28)24-23(26)22-10-9-18(31-22)14-30-21-8-4-6-15-5-2-3-7-20(15)21/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | YXSKVXXWCUTQSV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|