C26H21ClN2O6 — CID 19458705
5-[(2-chlorophenoxy)methyl]-N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19458705) has the molecular formula C26H21ClN2O6 and a molecular weight of 492.92 g/mol. Its IUPAC name is 5-[(2-chlorophenoxy)methyl]-N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-chlorophenoxy)methyl]-N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19458705 |
| Molecular Formula | C26H21ClN2O6 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 5-[(2-chlorophenoxy)methyl]-N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)cc(Oc2cc(NC(=O)c3ccc(COc4ccccc4Cl)o3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H21ClN2O6/c1-16-9-17(2)11-21(10-16)34-22-13-18(12-19(14-22)29(31)32)28-26(30)25-8-7-20(35-25)15-33-24-6-4-3-5-23(24)27/h3-14H,15H2,1-2H3,(H,28,30) |
| InChIKey | RSZXYYFYVBRLQD-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|