C26H20N2O8 — CID 19464007
5-(1,3-benzodioxol-5-yloxymethyl)-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide (PubChem CID 19464007) has the molecular formula C26H20N2O8 and a molecular weight of 488.45 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yloxymethyl)-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19464007 |
| Molecular Formula | C26H20N2O8 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yloxymethyl)-N-[3-(3-methylphenoxy)-5-nitrophenyl]furan-2-carboxamide |
| SMILES | Cc1cccc(Oc2cc(NC(=O)c3ccc(COc4ccc5c(c4)OCO5)o3)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H20N2O8/c1-16-3-2-4-20(9-16)35-22-11-17(10-18(12-22)28(30)31)27-26(29)24-8-6-21(36-24)14-32-19-5-7-23-25(13-19)34-15-33-23/h2-13H,14-15H2,1H3,(H,27,29) |
| InChIKey | FQEYLVRUVMDLGY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|