C22H13BrF3N5O7 — CID 19465298
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide (PubChem CID 19465298) has the molecular formula C22H13BrF3N5O7 and a molecular weight of 596.27 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465298 |
| Molecular Formula | C22H13BrF3N5O7 |
| Molecular Weight | 596.27 g/mol |
| Exact Mass | 595.00 |
| IUPAC Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Oc2cccc(C(F)(F)F)c2)cc([N+](=O)[O-])c1)c1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1 |
| InChI | InChI=1S/C22H13BrF3N5O7/c23-18-11-29(28-20(18)31(35)36)10-16-4-5-19(38-16)21(32)27-13-7-14(30(33)34)9-17(8-13)37-15-3-1-2-12(6-15)22(24,25)26/h1-9,11H,10H2,(H,27,32) |
| InChIKey | YVVXZOODNNQUSI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.27 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|