C15H9BrCl2N4O4 — CID 19463467
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 19463467) has the molecular formula C15H9BrCl2N4O4 and a molecular weight of 460.07 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463467 |
| Molecular Formula | C15H9BrCl2N4O4 |
| Molecular Weight | 460.07 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1 |
| InChI | InChI=1S/C15H9BrCl2N4O4/c16-10-7-21(20-14(10)22(24)25)6-9-2-4-13(26-9)15(23)19-8-1-3-11(17)12(18)5-8/h1-5,7H,6H2,(H,19,23) |
| InChIKey | NWPQQKPVWGWGHA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.07 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|